From 21a9c6c139dbadb6047e4b8f06a14a8e560eb66e Mon Sep 17 00:00:00 2001
From: Sepehr Bayat <bayats1@mcmaster.ca>
Date: Sun, 28 Jan 2018 12:38:29 -0500
Subject: [PATCH] Upload New File
---
Tutorials/T04-A2Example/slides/T4.tex | 580 ++++++++++++++++++++++++++
1 file changed, 580 insertions(+)
create mode 100644 Tutorials/T04-A2Example/slides/T4.tex
diff --git a/Tutorials/T04-A2Example/slides/T4.tex b/Tutorials/T04-A2Example/slides/T4.tex
new file mode 100644
index 00000000..8abf50f4
--- /dev/null
+++ b/Tutorials/T04-A2Example/slides/T4.tex
@@ -0,0 +1,580 @@
+% Define Document Class
+% Class Options Include:
+% notes, notesonly, handout, trans,
+% hidesubsections, shadesubsections,
+% inrow, blue, red, grey, brown
+%--------------------------------------------------------------------------
+\documentclass[xcolor=dvipsnames, shownotes, colorlinks]{beamer}
+%--------------------------------------------------------------------------
+
+% Define Package Theme
+%--------------------------------------------------------------------------
+\usepackage{color}
+\usepackage{multirow}
+\usepackage[T1]{fontenc}
+%% \usepackage{fix-cm}
+\usepackage{hyperref}
+\usepackage[utf8]{inputenc}
+\usepackage[british]{babel}
+\usepackage{tabularx}
+
+\hypersetup{
+ urlcolor=cyan,
+ linkcolor=white
+}
+\usepackage{subfigure}
+%% \usepackage{xspace}
+\usepackage{}
+\usepackage{enumerate}
+\usetheme{Antibes}
+\setbeamertemplate{sidebar}[right]
+\usepackage{listings} % Code formatting
+%% \usepackage{framed}
+%% \usepackage{booktabs}
+\usepackage{tabularx}
+\usepackage{marvosym}
+\usepackage{tikz}
+
+\usetikzlibrary{shapes}
+\usetikzlibrary{arrows}
+\usetikzlibrary{calc,positioning}
+
+\lstset{
+ language=Python,
+ basicstyle=\ttfamily\scriptsize,
+ tabsize=2,
+ breaklines=true,
+ prebreak=\raisebox{0ex}[0ex][0ex]{\ensuremath{\hookleftarrow}},
+ frame=single,
+ showstringspaces=true,
+ showspaces=false,
+ keywordstyle=\color{blue},
+ stringstyle=\color{magenta},
+ commentstyle=\color{ForestGreen},
+ literate={\#}{{\textcolor{ForestGreen}{\#}}}1 {@}{{\textcolor{blue}{\MVAt}}}1 {\$}{\vdots}1
+}
+%--------------------------------------------------------------------------
+
+% Commands
+%------------------------------------------------------------------------------
+
+\newcommand*\oldmacro{}%
+\let\oldmacro\insertshorttitle%
+\renewcommand*\insertshorttitle{%
+ \oldmacro\hfill%
+ \insertframenumber\,/\,\inserttotalframenumber}
+
+% Figure Source
+\usepackage[absolute,overlay]{textpos}
+
+\setbeamercolor{framesource}{fg=gray}
+\setbeamerfont{framesource}{size=\tiny}
+
+\newcommand{\source}[1]{\begin{textblock*}{\paperwidth}(-5pt,\textheight)
+ \begin{beamercolorbox}[ht=0.5cm,right]{framesource}
+ \usebeamerfont{framesource}\usebeamercolor[fg]{framesource} Source: {#1}
+ \end{beamercolorbox}
+\end{textblock*}}
+
+%------------------------------------------------------------------------------
+
+
+% Presentation Title Slide
+%--------------------------------------------------------------------------
+\title{MIS Example}
+\subtitle{CS 2ME3/SE 2AA4}
+\author{Sepehr Bayat}
+\institute{Department of Computing and Software\\
+McMaster University\\ }
+\date{January 29}
+%--------------------------------------------------------------------------
+
+
+% Document
+% To add notes to the slides use: \note{}
+% Add \section{} or \subsection{} for use in table of contents
+%--------------------------------------------------------------------------
+\begin{document}
+
+% Create Title Slide
+\begin{frame}
+\maketitle
+\end{frame}
+
+\section[Outline]{}
+% Create Table of Contents Slide - Outline
+\begin{frame}
+\frametitle{Outline}
+ {\hypersetup{linkcolor=black}
+ \tableofcontents
+ }
+\end{frame}
+
+\section{What is a module?}
+
+\begin{frame}
+ \frametitle{What is a module?}
+ \begin{itemize} \item A file with encapsulated code to implement a specific functionality
+ \item Ex: For designing a website with a login system, we may have a module that deals with logging out
+ \item A module comes with an "interface"
+ \item An interface includes things like functions and arguments of the function
+ \end{itemize}
+\end{frame}
+
+% --------------------------------------------------
+
+
+% --------------------------------------------------
+
+\begin{frame}
+ \frametitle{What is a MIS?}
+ \begin{itemize} \item Module Interface Specification
+ \item Specifices externally observable behaviour of a module
+ \item Not in language of implementation, but uses mathematical and application language
+ \item Internal implementations are not included in a MIS
+ \end{itemize}
+
+\end{frame}
+
+% --------------------------------------------------
+
+% --------------------------------------------------
+
+\section{MIS Template}
+\begin{frame}
+ \frametitle{MIS Template Structure}
+ \begin{itemize}
+ \item Uses
+ \begin{itemize}
+ \item Imported constants, data types and access programs
+ \end{itemize}
+ \item Syntax
+ \begin{itemize}
+ \item Exported constants and types
+ \item Exported functions (access routine interface syntax)
+ \end{itemize}
+ \item Semantics
+ \begin{itemize}
+ \item State variables
+ \item State invariants
+ \item Assumptions
+ \item Access routine semantics
+ \item Local functions
+ \item Local types
+ \item Local constants
+ \item Considerations
+ \end{itemize}
+ \end{itemize}
+
+\end{frame}
+
+% --------------------------------------------------
+
+
+
+% --------------------------------------------------
+
+\section{Example}
+\begin{frame}
+ \frametitle{Example }
+ Consider implementation of point on two dimensional plane
+ \begin{itemize}
+ \item Position P is represented by pair of real numbers (x,y)
+ \item A triangle is represented by three points
+ \item Considering we have three points in a 2D surface and we want to know the possibility of having a triangle with the three points and then calculate the perimeter and the area of the triangle.
+
+ \end{itemize}
+ \end {frame}
+% --------------------------------------------------
+
+% --------------------------------------------------
+%\section{Example}
+\begin{frame}
+ Consider the following triangle:
+ \begin{figure}[h]
+ \centering
+ \includegraphics[width=0.5\textwidth]{triangle.png}
+ \end{figure}
+ We are using the following inequality which is called inequality equation to know the possibility of having triangle with three points A, B and C:
+
+\end{frame}
+% --------------------------------------------------
+
+% --------------------------------------------------
+%\section{Example}
+\begin{frame}
+ \begin{itemize}
+\item $$ \mathrm{AB + AC < BC, AC + BC < AB, AB + BC < AC}$$
+ \end{itemize}
+We are calculating the perimeter of the triangle using the following formula:
+\begin{itemize}
+\item $$\mathrm {P = (AB+AC+BC)}$$
+\end{itemize}
+We are using the Heron formula to calculate the area of the triangle:
+\begin {itemize}
+\item $$ \mathrm {\sqrt[2]{P/2(P/2-AB)(P/2-AC)(P/2-BC)}}$$
+\end{itemize}
+
+ \end {frame}
+
+\subsection{Point ADT Module}
+
+\begin{frame}
+\frametitle{Point ADT Module }
+
+\textbf{Template Module}\\
+pointADT
+\newline
+
+\textbf{Uses}\\
+N/A
+\newline
+
+\textbf{Syntax}\\
+Exported Types:
+\newline
+pointT = ?
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Exported Access Programs}\\
+~\newline
+
+\begin{tabular}{| l | l | l | l |}
+\hline
+\textbf{Routine name} & \textbf{In} & \textbf{Out} & \textbf{Exceptions}\\
+\hline
+init & real, real & pointT & ~\\
+\hline
+xcoord & ~ & real & ~\\
+\hline
+ycoord & ~ & real & ~\\
+\hline
+dist & pointT & real & ~\\
+\hline
+\end{tabular}
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Semantics}
+
+State Variables:
+
+$xc$: real\\
+$yc$: real
+
+~\newline
+\textbf{State Invariant}
+None
+
+~\newline
+\textbf{Assumptions}
+init() is called for each abstract object before any other access routine is called for that object
+
+
+
+
+\end{frame}
+
+
+% --------------------------------------------------
+
+
+\begin{frame}
+
+\frametitle{Point ADT Module}
+
+\textbf{Access Routine Semantics}\\
+
+init($x, y$):
+\begin{itemize}
+\item transition: $xc, yc := x, y$
+\item output: $out := \mathit{self}$
+\item exception: none
+\end{itemize}
+
+\noindent xcoord():
+\begin{itemize}
+\item output: $out := xc$
+\item exception: none
+\end{itemize}
+
+\noindent ycoord():
+\begin{itemize}
+\item output: $out := yc$
+\item exception: none
+\end{itemize}
+
+\noindent dist($p$):
+\begin{itemize}
+\item output: $out := \sqrt{(\mathit{self}.xc - p.\mbox{xcoord()})^2 + (\mathit{self}.yc - p.\mbox{ycoord()})^2}$
+
+\item exception: none
+\end{itemize}
+
+
+
+
+\end{frame}
+
+
+
+% --------------------------------------------------
+
+
+\begin{frame}[fragile]
+
+\frametitle{MIS Interface}
+
+From the MIS we can deduce the interface of the code will look like:
+
+ \begin{lstlisting}
+ # Interface
+ class pointT:
+
+ # Constructor
+ def __init__(self, x, y):
+
+ # Selectors
+ def xcoord(self):
+
+ def ycoord(self):
+
+ def dist(self, p):
+
+ \end{lstlisting}
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+ \frametitle{MIS Implementation}
+ \begin{center}
+ \textbf{See PointADT.py for implementation.}\\
+ \end{center}
+
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+
+%
+%
+%
+%
+%
+%
+
+% --------------------------------------------------
+
+\subsection{TriangleADT Module }
+\begin{frame}
+ \frametitle{TriangleADT }
+
+\textbf{Template Module}\\
+TriangleADT
+\newline
+
+\textbf{Uses}\\
+PointADT
+\newline
+
+\textbf{Syntax}\\
+Exported Types:
+\newline
+TriangleADT = ?\\
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Exported Access Programs}\\
+~\newline
+\tabcolsep=0.09cm
+\begin{tabular}{| l | l | l | l |}
+\hline
+\textbf{Routine name} & \textbf{In} & \textbf{Out} & \textbf{Exceptions}\\
+%\hline
+%init & \multirow{2}{*}{Note 1} & Triangle & \\ \cline{1-3}
+\hline
+init & pointT,pointT,pointT&TriangleADT & ~\\
+\hline
+sides & & &~\\
+\hline
+inequality theorem & ~ & boolean & LINE~\\
+\hline
+perimeter of triangle & & real & LINE ~\\
+\hline
+area of triangle & & real & LINE ~\\
+\hline
+\end{tabular}
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Semantics}
+
+State Variables:
+
+$p1$: pointT\\
+$p2$: pointT\\
+$p3$: pointT\\
+$AB$: real\\
+$AC$ : real\\
+$BC$ : real\\
+~\newline
+\textbf{State Invariant}
+None
+
+~\newline
+\textbf{Assumptions}
+init() is called for each abstract object before any other access routine is called for that object
+
+
+
+
+\end{frame}
+
+
+% --------------------------------------------------
+
+\begin{frame}
+
+
+\textbf{Access Routine Semantics}\\
+
+init($p1, p2, p3$):
+\begin{itemize}
+\item transition: $a, b, c := p1, p2, p3$
+\item output: $out := \mathit{self}$
+\item exception: none
+\end{itemize}
+\noindent sides():
+\begin{itemize}
+\item transition: $AB, AC, BC := pointT.dist(self.a,self.b),$
+\\ $pointT.dist(slef.a,self.c), pointT.dist(self.b,self.c)$
+\item output: $out := \mathit{self}$
+\item exception: none
+\end{itemize}
+\end {frame}
+
+
+
+
+\begin {frame}
+\noindent inequality theorem():
+\begin{itemize}
+\item output: $$out := \mathrm {(self.AB +self.AC > self.BC,and, self.AB+self.BC }$$
+ $$ \mathrm {> self.AC, and, self.AC+self.BC >self.AB)}$$
+\item exception:
+\\ ex := (self.a.xcoord()==self.b.xcoord() ==self.c.xcoord() or
+\\ self.a.ycoord()==self.b.ycoord() ==self.c.ycoord()) $\Rightarrow \mbox{LINE})$
+\end{itemize}
+
+
+
+\end{frame}
+
+
+% --------------------------------------------------
+
+\begin{frame}
+\noindent perimeter of triangle($ $):
+\begin{itemize}
+\item output: $$out := \mathrm{self.AB+self.AC+self.BC}$$
+\item exception:
+\\ ex := (self.a.xcoord()==self.b.xcoord() ==self.c.xcoord() or
+\\ self.a.ycoord()==self.b.ycoord() ==self.c.ycoord()) $\Rightarrow \mbox{LINE})$
+
+\end{itemize}
+\noindent area of triangle($ $):
+\begin{itemize}
+\item output : $$out :=\mathit {\sqrt[2]{P/2(P/2-self.AB)(P/2-self.AC)(P/2-self.BC)}}$$
+\item exception:
+\\ ex := (self.a.xcoord()==self.b.xcoord() ==self.c.xcoord() or
+\\ self.a.ycoord()==self.b.ycoord() ==self.c.ycoord()) $\Rightarrow \mbox{LINE})$
+\end{itemize}
+
+\textbf{Local Constants}\\
+P := self.AB+self.AC+self.BC
+
+
+
+\end{frame}
+
+
+
+% --------------------------------------------------
+
+
+\begin{frame}[fragile]
+
+\frametitle{MIS Interface}
+
+From the MIS we can deduce the interface of the code will look like:
+
+ \begin{lstlisting}
+ # Interface
+ class TriangleADT:
+
+ #Constructor
+ def __init__(self, p1, p2, p3):
+
+
+ #Selectors
+ def sides(self):
+
+ def inequality theorem(self):
+
+ def perimeter of triangle(self):
+
+ def area of triangle(self):
+
+ \end{lstlisting}
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+ \frametitle{MIS Implementation}
+ \begin{center}
+ \textbf{See TriangleADT for implementation.}\\
+ \end{center}
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+
+
+% -----------------------------------------------------
+\begin{frame}
+ \frametitle{Implementation files}
+ \begin{itemize}
+ \item Implementation files PointADT.py and TriangleADT.py can be found in the repo under Tutorial/T4/src
+ \end{itemize}
+
+\end{frame}
+
+
+
+\end{document}
--
GitLab