Upload New File

Tutorials/T04-A2Example/slides/T4.tex

+% Define Document Class
+% Class Options Include:
+%    notes, notesonly, handout, trans,
+%    hidesubsections, shadesubsections,
+%     inrow, blue, red, grey, brown
+%--------------------------------------------------------------------------
+\documentclass[xcolor=dvipsnames, shownotes, colorlinks]{beamer}
+%--------------------------------------------------------------------------
+
+% Define Package Theme  
+%--------------------------------------------------------------------------
+\usepackage{color}
+\usepackage{multirow}
+\usepackage[T1]{fontenc}
+%% \usepackage{fix-cm}
+\usepackage{hyperref}
+\usepackage[utf8]{inputenc}
+\usepackage[british]{babel}
+\usepackage{tabularx}
+
+\hypersetup{
+    urlcolor=cyan,
+    linkcolor=white
+}
+\usepackage{subfigure}
+%% \usepackage{xspace}
+\usepackage{}
+\usepackage{enumerate}
+\usetheme{Antibes}
+\setbeamertemplate{sidebar}[right]
+\usepackage{listings} % Code formatting
+%% \usepackage{framed}
+%% \usepackage{booktabs}
+\usepackage{tabularx}
+\usepackage{marvosym}
+\usepackage{tikz}
+
+\usetikzlibrary{shapes}
+\usetikzlibrary{arrows}
+\usetikzlibrary{calc,positioning}
+
+\lstset{
+    language=Python,
+    basicstyle=\ttfamily\scriptsize,
+    tabsize=2,
+    breaklines=true,
+    prebreak=\raisebox{0ex}[0ex][0ex]{\ensuremath{\hookleftarrow}},
+    frame=single,
+    showstringspaces=true,
+    showspaces=false,
+    keywordstyle=\color{blue},
+    stringstyle=\color{magenta},
+    commentstyle=\color{ForestGreen},
+    literate={\#}{{\textcolor{ForestGreen}{\#}}}1 {@}{{\textcolor{blue}{\MVAt}}}1 {\$}{\vdots}1
+}
+%--------------------------------------------------------------------------
+
+% Commands
+%------------------------------------------------------------------------------
+
+\newcommand*\oldmacro{}%
+\let\oldmacro\insertshorttitle%
+\renewcommand*\insertshorttitle{%
+  \oldmacro\hfill%
+  \insertframenumber\,/\,\inserttotalframenumber}
+
+% Figure Source
+\usepackage[absolute,overlay]{textpos}
+
+\setbeamercolor{framesource}{fg=gray}
+\setbeamerfont{framesource}{size=\tiny}
+
+\newcommand{\source}[1]{\begin{textblock*}{\paperwidth}(-5pt,\textheight)
+    \begin{beamercolorbox}[ht=0.5cm,right]{framesource}
+        \usebeamerfont{framesource}\usebeamercolor[fg]{framesource} Source: {#1}
+    \end{beamercolorbox}
+\end{textblock*}}
+
+%------------------------------------------------------------------------------
+
+
+% Presentation Title Slide
+%--------------------------------------------------------------------------
+\title{MIS Example}
+\subtitle{CS 2ME3/SE 2AA4}
+\author{Sepehr Bayat}
+\institute{Department of Computing and Software\\
+McMaster University\\ }
+\date{January 29}               
+%--------------------------------------------------------------------------
+
+
+% Document
+%   To add notes to the slides use: \note{}
+%  Add \section{} or \subsection{} for use in table of contents
+%--------------------------------------------------------------------------
+\begin{document}
+
+% Create Title Slide
+\begin{frame}
+\maketitle
+\end{frame}
+
+\section[Outline]{}
+% Create Table of Contents Slide - Outline
+\begin{frame}
+\frametitle{Outline}
+  {\hypersetup{linkcolor=black}
+  \tableofcontents
+  }
+\end{frame}
+
+\section{What is a module?}
+
+\begin{frame}
+	\frametitle{What is a module?}
+                \begin{itemize} \item A file with encapsulated code to implement a specific functionality
+                                       \item Ex: For designing a website with a login system, we may have a module that deals with logging out
+                                       \item A module comes with an "interface"
+			\item An interface includes things like functions and arguments of the function
+                \end{itemize}
+\end{frame}
+
+% --------------------------------------------------
+
+
+% --------------------------------------------------
+
+\begin{frame}
+	\frametitle{What is a MIS?}
+                \begin{itemize} \item Module Interface Specification
+                                       \item Specifices externally observable behaviour of a module
+			\item Not in language of implementation, but uses mathematical and application language
+			\item Internal implementations are not included in a MIS
+	 \end{itemize}
+             
+\end{frame}
+
+% --------------------------------------------------
+
+% --------------------------------------------------
+
+\section{MIS Template}
+\begin{frame}
+	\frametitle{MIS Template Structure}
+             \begin{itemize}
+	\item Uses
+	\begin{itemize}
+	\item Imported constants, data types and access programs
+	\end{itemize}
+	\item Syntax
+	\begin{itemize}
+	\item Exported constants and types
+	\item Exported functions (access routine interface syntax)
+	\end{itemize}
+	\item Semantics
+	\begin{itemize}
+	\item State variables
+	\item State invariants
+	\item Assumptions
+	\item Access routine semantics
+	\item Local functions
+	\item Local types
+	\item Local constants
+	\item Considerations
+	\end{itemize}
+	\end{itemize}
+             
+\end{frame}
+
+% --------------------------------------------------
+
+
+
+% --------------------------------------------------
+
+\section{Example}
+\begin{frame}
+	\frametitle{Example }
+	Consider implementation of point on two dimensional plane
+  	 \begin{itemize} 
+		\item Position P is represented by pair of real numbers (x,y)
+		\item A triangle is represented by three points
+		\item Considering we have three points in a 2D surface and we want to know the possibility of having a triangle with the three points and then calculate the perimeter and the area of the triangle. 
+	
+ \end{itemize}
+ \end {frame}
+% --------------------------------------------------
+
+% --------------------------------------------------
+%\section{Example}
+\begin{frame}
+        	     Consider the following triangle:
+               \begin{figure}[h]
+    \centering
+    \includegraphics[width=0.5\textwidth]{triangle.png}
+  \end{figure}
+     We are using the following inequality which is called inequality equation to know the possibility of having triangle with three points A, B and C:
+             
+\end{frame}
+% --------------------------------------------------
+
+% --------------------------------------------------
+%\section{Example}
+\begin{frame}
+ \begin{itemize} 
+\item  $$ \mathrm{AB + AC < BC, AC + BC < AB, AB + BC < AC}$$
+ \end{itemize}
+We are calculating the perimeter of the triangle using the following formula:
+\begin{itemize}
+\item $$\mathrm {P = (AB+AC+BC)}$$
+\end{itemize}
+We are using the Heron formula to calculate the area of the triangle:
+\begin {itemize}
+\item  $$ \mathrm {\sqrt[2]{P/2(P/2-AB)(P/2-AC)(P/2-BC)}}$$
+\end{itemize}
+
+ \end {frame}
+
+\subsection{Point ADT Module}
+
+\begin{frame}
+\frametitle{Point ADT Module }
+
+\textbf{Template Module}\\
+pointADT
+\newline
+
+\textbf{Uses}\\
+N/A
+\newline
+
+\textbf{Syntax}\\
+Exported Types:
+\newline
+pointT = ?
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Exported Access Programs}\\
+~\newline
+
+\begin{tabular}{| l | l | l | l |}
+\hline
+\textbf{Routine name} & \textbf{In} & \textbf{Out} & \textbf{Exceptions}\\
+\hline
+init & real, real & pointT & ~\\
+\hline
+xcoord & ~ & real & ~\\
+\hline
+ycoord & ~ & real & ~\\
+\hline
+dist & pointT & real & ~\\
+\hline
+\end{tabular}
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Semantics}
+
+State Variables:
+
+$xc$: real\\
+$yc$: real
+
+~\newline
+\textbf{State Invariant}
+None
+
+~\newline
+\textbf{Assumptions}
+init() is called for each abstract object before any other access routine is called for that object
+
+
+
+
+\end{frame}
+
+
+% --------------------------------------------------
+
+
+\begin{frame}
+
+\frametitle{Point ADT Module}
+
+\textbf{Access Routine Semantics}\\
+
+init($x, y$):
+\begin{itemize}
+\item transition: $xc, yc := x, y$
+\item output: $out := \mathit{self}$
+\item exception: none
+\end{itemize}
+
+\noindent xcoord():
+\begin{itemize}
+\item output: $out := xc$
+\item exception: none
+\end{itemize}
+
+\noindent ycoord():
+\begin{itemize}
+\item output: $out := yc$
+\item exception: none
+\end{itemize}
+
+\noindent dist($p$):
+\begin{itemize}
+\item output: $out := \sqrt{(\mathit{self}.xc - p.\mbox{xcoord()})^2 + (\mathit{self}.yc - p.\mbox{ycoord()})^2}$
+
+\item exception: none
+\end{itemize}
+
+
+   
+             
+\end{frame}
+
+
+
+% --------------------------------------------------
+
+
+\begin{frame}[fragile]
+
+\frametitle{MIS Interface}
+
+From the MIS we can deduce the interface of the code will look like:
+
+	\begin{lstlisting}
+	# Interface
+	class pointT:
+	
+	    # Constructor
+	    def __init__(self, x, y):
+	      
+	    # Selectors
+	    def xcoord(self):
+	
+	    def ycoord(self):
+	
+	    def dist(self, p):
+	  
+	\end{lstlisting}
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+	\frametitle{MIS Implementation}
+	\begin{center}
+	\textbf{See PointADT.py for implementation.}\\
+	\end{center}
+
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+
+%
+%
+%
+%
+%
+%
+
+% --------------------------------------------------
+
+\subsection{TriangleADT Module }
+\begin{frame}
+	\frametitle{TriangleADT }
+
+\textbf{Template Module}\\
+TriangleADT
+\newline
+
+\textbf{Uses}\\
+PointADT
+\newline
+
+\textbf{Syntax}\\
+Exported Types:
+\newline
+TriangleADT = ?\\
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Exported Access Programs}\\
+~\newline
+\tabcolsep=0.09cm
+\begin{tabular}{| l | l | l | l |}
+\hline
+\textbf{Routine name} & \textbf{In} & \textbf{Out} & \textbf{Exceptions}\\
+%\hline
+%init & \multirow{2}{*}{Note 1}  & Triangle & \\ \cline{1-3}
+\hline
+init & pointT,pointT,pointT&TriangleADT & ~\\
+\hline
+sides & & &~\\
+\hline
+inequality theorem & ~ & boolean & LINE~\\
+\hline
+perimeter of triangle & & real  & LINE ~\\
+\hline
+area of triangle &  & real & LINE ~\\
+\hline
+\end{tabular}
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+
+\textbf{Semantics}
+
+State Variables:
+
+$p1$: pointT\\
+$p2$: pointT\\
+$p3$: pointT\\
+$AB$: real\\
+$AC$ : real\\
+$BC$ : real\\
+~\newline
+\textbf{State Invariant}
+None
+
+~\newline
+\textbf{Assumptions}
+init() is called for each abstract object before any other access routine is called for that object
+
+
+
+
+\end{frame}
+
+
+% --------------------------------------------------
+
+\begin{frame}
+
+
+\textbf{Access Routine Semantics}\\
+
+init($p1, p2, p3$):
+\begin{itemize}
+\item transition: $a, b, c := p1, p2, p3$
+\item output: $out := \mathit{self}$
+\item exception: none
+\end{itemize}
+\noindent sides():
+\begin{itemize}
+\item transition: $AB, AC, BC := pointT.dist(self.a,self.b),$
+\\ $pointT.dist(slef.a,self.c), pointT.dist(self.b,self.c)$
+\item output: $out := \mathit{self}$
+\item exception: none
+\end{itemize}
+\end {frame}
+
+
+
+
+\begin {frame}
+\noindent inequality theorem():
+\begin{itemize}
+\item output: $$out := \mathrm {(self.AB +self.AC > self.BC,and, self.AB+self.BC }$$
+	     $$ \mathrm {> self.AC, and,  self.AC+self.BC >self.AB)}$$
+\item exception: 
+\\ ex := (self.a.xcoord()==self.b.xcoord() ==self.c.xcoord() or 
+\\ self.a.ycoord()==self.b.ycoord() ==self.c.ycoord()) $\Rightarrow \mbox{LINE})$
+\end{itemize}
+
+
+
+\end{frame}
+
+
+% --------------------------------------------------
+
+\begin{frame}
+\noindent perimeter of triangle($ $):
+\begin{itemize}
+\item output: $$out := \mathrm{self.AB+self.AC+self.BC}$$
+\item exception: 
+\\ ex := (self.a.xcoord()==self.b.xcoord() ==self.c.xcoord() or 
+\\ self.a.ycoord()==self.b.ycoord() ==self.c.ycoord()) $\Rightarrow \mbox{LINE})$
+
+\end{itemize}
+\noindent area of triangle($ $):
+\begin{itemize}
+\item  output : $$out :=\mathit {\sqrt[2]{P/2(P/2-self.AB)(P/2-self.AC)(P/2-self.BC)}}$$
+\item exception: 
+\\ ex := (self.a.xcoord()==self.b.xcoord() ==self.c.xcoord() or 
+\\ self.a.ycoord()==self.b.ycoord() ==self.c.ycoord()) $\Rightarrow \mbox{LINE})$
+\end{itemize}
+
+\textbf{Local Constants}\\
+P := self.AB+self.AC+self.BC
+
+
+             
+\end{frame}
+
+
+
+% --------------------------------------------------
+
+
+\begin{frame}[fragile]
+
+\frametitle{MIS Interface}
+
+From the MIS we can deduce the interface of the code will look like:
+
+	\begin{lstlisting}
+	# Interface
+	class TriangleADT:
+	
+	    #Constructor
+	    def __init__(self, p1, p2, p3):
+	      
+	
+	    #Selectors
+	    def sides(self):
+	    
+	    def inequality theorem(self):
+
+	    def perimeter of triangle(self):
+	    
+	    def area of triangle(self):
+
+	\end{lstlisting}
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+\begin{frame}
+	\frametitle{MIS Implementation}
+	\begin{center}
+	\textbf{See TriangleADT for implementation.}\\
+	\end{center}
+
+
+\end{frame}
+
+% --------------------------------------------------
+
+
+
+% -----------------------------------------------------
+\begin{frame}
+	\frametitle{Implementation files}
+	\begin{itemize}
+	\item Implementation files PointADT.py and TriangleADT.py can be found in the repo under Tutorial/T4/src
+	\end{itemize}
+
+\end{frame}
+
+
+
+\end{document}